| Name | 2-chloro-4-fluoro-1-nitrobenzene |
| Synonyms | 2-Chloro-4-Fluoronitrobenzene 2-Chloro-4-fluoronitrobenzene 4-fluoro-2-chloronitrobenzene 2-CHLORO-4-FLUORONITROBENZENE 2-chloro-4-fluoronitrobenzenen 1-Chloro-5-fluoro-2-nitroBenzene 2-chloro-4-fluoro-1-nitrobenzene 3-Chloro-1-fluoro-4-nitrobenzene Benzene, 2-chloro-4-fluoro-1-nitro- |
| CAS | 2106-50-5 |
| EINECS | 218-286-2 |
| InChI | InChI=1/C6H3ClFNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H |
| Molecular Formula | C6H3ClFNO2 |
| Molar Mass | 175.54 |
| Density | 1.494±0.06 g/cm3(Predicted) |
| Melting Point | 34-37°C |
| Boling Point | 71°C/2.3mmHg(lit.) |
| Flash Point | 96.8°C |
| Solubility | DMSO (Sparingly), Methanol (Slightly) |
| Vapor Presure | 0.0728mmHg at 25°C |
| Appearance | Solid |
| Color | Light Yellow Low-Melting |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.554 |
| MDL | MFCD03412200 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R36/38 - Irritating to eyes and skin. R21/22 - Harmful in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 2811 |
| HS Code | 29049090 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | Ⅲ |