| Name | 1-(4-Morpholino)-2-propanol |
| Synonyms | 1-MORPHOLINO-2-PROPANOL 1-N-MORPHOLINO-2-PROPANOL 1-(4-MORPHOLINO)-2-PROPANOL 1-(4-Morpholino)-2-propanol 1-morpholin-4-yl-propan-2-ol 4-(2-Hydroxypropyl)morpholine N-(2-HYDROXYPROPYL)MORPHOLINE N-(2-Hydroxypropyl)morpholine 1-(morpholin-4-yl)propan-2-ol alpha-methyl-4-morpholineethano (2S)-1-morpholin-4-ylpropan-2-ol ALPHA-METHYL-4-MORPHOLINEETHANOL |
| CAS | 2109-66-2 |
| EINECS | 218-298-8 |
| InChI | InChI=1/C7H15NO2/c1-7(9)6-8-2-4-10-5-3-8/h7,9H,2-6H2,1H3/t7-/m0/s1 |
| Molecular Formula | C7H15NO2 |
| Molar Mass | 145.2 |
| Density | 1,02 g/cm3 |
| Boling Point | 94-96°C 17mm |
| Flash Point | 92°C |
| Vapor Presure | 0.0102mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Yellow to Orange |
| BRN | 1443 |
| pKa | 14.95±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.4620 |
| MDL | MFCD00023378 |
| Risk Codes | 36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| TSCA | Yes |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| application | N-(2-hydroxypropyl) morpholine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and pharmaceutical and chemical production process. |