| Name | (3-Benzoylphenyl)-Acetonitrile |
| Synonyms | RU 5029 Ketoprofen EP impurity I 3-Benzoylphenylacetonitrile m-Benzoylphenylacetonitrile BENZOPHENONE-3-PROPIONITRILE 3-Benzoylbenzeneacetonitrile (3-Benzoylphenyl)-Acetonitrile (3-benzoylphenyl)ethanenitrile Ketoprofen Impurity 9(Ketoprofen EP Impurity I) |
| CAS | 21288-34-6 |
| EINECS | 244-315-3 |
| InChI | InChI=1/C15H11NO/c16-10-9-12-5-4-8-14(11-12)15(17)13-6-2-1-3-7-13/h1-8,11H,9H2 |
| Molecular Formula | C15H11NO |
| Molar Mass | 221.25 |
| Density | 1.141g/cm3 |
| Boling Point | 406.2°C at 760 mmHg |
| Flash Point | 199.4°C |
| Solubility | Chloroform (Sparingly), Methanol (Slightly) |
| Vapor Presure | 8.3E-07mmHg at 25°C |
| Appearance | Solid |
| Color | Colourless to Light Yellow Oil to |
| Storage Condition | Refrigerator |
| Refractive Index | 1.591 |