| Name | 1H-indazol-7-amine |
| Synonyms | AI3-52441 NSC 170661 BRN 0003640 7-AMinoindazole 7-Aminoindazole 1H-indazol-7-amine 1H-Indazol-7-amine 1H-INDAZOL-7-AMINE 1H-Indazol-5-ylamine 7-AMINO (1H)INDAZOLE 1H-Indazol-7-ylaMine 4-25-00-02526 (Beilstein Handbook Reference) |
| CAS | 21443-96-9 |
| EINECS | 244-391-8 |
| InChI | InChI=1/C7H7N3/c8-6-3-1-2-5-4-9-10-7(5)6/h1-4H,8H2,(H,9,10) |
| Molecular Formula | C7H7N3 |
| Molar Mass | 133.15 |
| Density | 1.367±0.06 g/cm3(Predicted) |
| Melting Point | 157-163 °C |
| Boling Point | 376.6±15.0 °C(Predicted) |
| Flash Point | 209.5°C |
| Vapor Presure | 7.16E-06mmHg at 25°C |
| Appearance | Crystalline Solid |
| Color | Tan |
| pKa | 14.89±0.40(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.78 |
| MDL | MFCD00022790 |
| Risk Codes | R34 - Causes burns R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3259 |
| WGK Germany | 3 |
| RTECS | NK7713000 |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |