216018-58-5 - Names and Identifiers
| Name | 2,2':6',2''-terpyridine-4,4',4''-tricarboxylic acid
|
| Synonyms | 216018-58-5 6',2''-TERPYRIDINE-4,4',4''-TRICARBOXYLIC ACID 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid 6',2'']Terpyridine-4,4',4''-tricarboxylic acid triMethyl ester
|
| CAS | 216018-58-5
|
| InChI | InChI=1/C18H11N3O6/c22-16(23)9-1-3-19-12(5-9)14-7-11(18(26)27)8-15(21-14)13-6-10(17(24)25)2-4-20-13/h1-8H,(H,22,23)(H,24,25)(H,26,27) |
216018-58-5 - Physico-chemical Properties
| Molecular Formula | C18H11N3O6
|
| Molar Mass | 365.3 |
| Density | 1.539 |
| Boling Point | 890.3±65.0 °C(Predicted) |
| Flash Point | 492.208°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 1.88±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.688 |
216018-58-5 - Introduction
2,2 ':6',2 ''-terpyridine-4,4 ',4''-tricarboxylic acid is an organic compound with the chemical formula C20H13N3O6. Its properties are as follows:
1. Appearance: 2,2 ':6',2 ''-terpyridine-4,4 ',4''-tricarboxylic acid is a white solid.
2. Solubility: it can be dissolved in water, can also be dissolved in some organic solvents, such as alcohols, esters and ketones.
3. Thermal stability: 2,2 ':6',2 ''-terpyridine-4,4 ',4''-tricarboxylic acid can exist stably at high temperature.
2,2 ':6',2 ''-terpyridine-4,4 ',4''-tricarboxylic acid is mainly used as follows:
1. Coordination ligand: It can be used as a coordination ligand of metal complexes and plays an important role in coordination chemistry and catalytic reactions.
2. Hybrid materials: Due to its special structure, 2,2 ':6',2 ''-terpyridine-4,4 ',4''-tricarboxylic acid can be used to prepare hybrid materials, such as metal-organic framework materials (MOFs) and coordination polymer materials.
3. Optoelectronic devices: its complexes have good photoelectric properties and can be used to prepare optoelectronic devices, such as organic light-emitting diodes (OLEDs) and dye-sensitized solar cells (DSSCs).
2,2 ':6',2 ''-terpyridine-4,4 ',4''-tricarboxylic acid is generally prepared by the following steps:
1. Mix pyridine and nitric acid and react at high temperature to produce 2,2 ':6',2 "-trinitropyridine.
2.2,2 ':6',2 ''-trinitropyridine reacts with ammonia to be reduced to 2,2 ':6',2''-triaminopyridine.
3.2,2 ':6',2 "-triaminopyridine is reacted with formic acid and hydrogen sulfide to generate 2,2 ':6',2"-tricarboxylic acid pyridine.
4. Oxidation of 2,2 ':6',2 ''-pyridine tricarboxylate to obtain the final product 2,2 ':6',2''-terpyridine-4,4 ',4 ''-tricarboxylic acid.
Last Update:2024-04-10 22:29:15