| Name | 2-Amino-5-fluoropyridine |
| Synonyms | 5-FLUORO-2-PYRIDINAMINE 5-FLUOROPYRIDIN-2-AMINE 5-fluoropyridin-2-amine 2-Amino-5-fluoropyridine 5-FLUORO-2-AMINOPYRIDINE 2-Amino-5-fluoroypyridine 5-FLUORO-PYRIDIN-2-YL-AMINE ethyl 2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate |
| CAS | 21717-96-4 |
| EINECS | 627-638-8 |
| InChI | InChI:1S/C5H5FN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
| Molecular Formula | C5H5FN2 |
| Molar Mass | 112.11 |
| Density | 1.257±0.06 g/cm3(Predicted) |
| Melting Point | 93-97 °C (lit.) |
| Boling Point | 125 °C |
| Flash Point | 100.8°C |
| Vapor Presure | 0.00555mmHg at 25°C |
| Appearance | Bright yellow crystal |
| Color | White to orange |
| BRN | 385938 |
| pKa | 4.62±0.13(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.411 |
| MDL | MFCD01861120 |
| Use | Used as pharmaceutical, pesticide intermediates |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S27 - Take off immediately all contaminated clothing. |
| UN IDs | UN2811 |
| WGK Germany | 3 |
| HS Code | 29333999 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | II |