| Name | 2,3-Dimethylbenzoyl chloride |
| Synonyms | 2,3-diMethyl chloride Dexmedetomidine Impurity 47 2,3-Dimethylbenzoyl chloride Benzoyl chloride, 2,3-dimethyl- benzoyl chloride, 2,3-dimethyl- 2,3-DIMETHYLBENZENE-1-CARBONYL CHLORIDE Benzoyl chloride, 2,3-dimethyl- (6CI,7CI,8CI,9CI) |
| CAS | 21900-46-9 |
| InChI | InChI=1/C9H9ClO/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5H,1-2H3 |
| Molecular Formula | C9H9ClO |
| Molar Mass | 168.62 |
| Density | 1.136±0.06 g/cm3(Predicted) |
| Melting Point | 2°C |
| Boling Point | 122 °C |
| Flash Point | 122-124°C |
| Vapor Presure | 0.0285mmHg at 25°C |
| Storage Condition | Room Temprature |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.5550 |
| MDL | MFCD00045217 |
| Risk Codes | R34 - Causes burns R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | 3265 |
| Hazard Note | Corrosive |
| Hazard Class | 8 |
| Packing Group | II |