| Name | 2-methylphenylalanine |
| Synonyms | DL-2-Me-Phe-OH TIMTEC-BB SBB003395 2-Methylphenylalanine 2-methylphenylalanine phenylalanine, 2-methyl- 2-Methy-DL-Phenylalanine 2-Methyl-DL-phenylalanine O-METHYL-DL-PHENYLALANINE 2-METHYL-DL-PHENYLALANINE DL-2'-methylphenylalanineHCl DL-2'-METHYLPHENYLALANINE HYDROCHLORIDE 2-amino-3-(2-methylphenyl)propanoic acid |
| CAS | 22888-51-3 |
| InChI | InChI=1/C10H13NO2/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13) |
| Molecular Formula | C10H13NO2 |
| Molar Mass | 179.22 |
| Density | 1.165 |
| Melting Point | 218.4-220.6 °C |
| Boling Point | 326.2±30.0 °C(Predicted) |
| Flash Point | 151.1°C |
| Vapor Presure | 8.9E-05mmHg at 25°C |
| pKa | 2.25±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.568 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |