| Name | 4-Phenyl-2-butanol |
| Synonyms | FEMA 2879 Phenylbutanol AURORA KA-6974 4-Phenyl-2-butanol 4-Phenylbutan-2-ol 4-phenylbutan-2-ol 4-PHENYL-2-BUTANOL (2R)-4-phenylbutan-2-ol alpha-methyl-benzenepropano PHENYLETHYL METHYL CARBINOL ALPHA-METHYL-BENZENEPROPANOL |
| CAS | 2344-70-9 |
| EINECS | 219-055-9 |
| InChI | InChI=1/C10H14O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m1/s1 |
| Molecular Formula | C10H14O |
| Molar Mass | 150.22 |
| Density | 0.970 g/mL at 25 °C (lit.) |
| Melting Point | 61 °C |
| Boling Point | 132 °C/14 mmHg (lit.) |
| Flash Point | 231°F |
| JECFA Number | 815 |
| Vapor Presure | 0.0147mmHg at 25°C |
| Appearance | liquid |
| BRN | 1908294 |
| pKa | 15.10±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.5140(lit.) |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29062900 |
| FEMA | 2879 | 4-PHENYL-2-BUTANOL |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): beverage 0.12~0.90; Cold drinks 0.60~6.0; Candy, baked goods, 1.5~15. Moderate amount is limited (FDA,§ 172.515,2001). |