| Name | 3,4,5-trifluorobenzylamine |
| Synonyms | RARECHEM AL BW 0701 Trifluorobenzylamine 345- 3,4,5-TRIFLUOROBENZYLAMINE 3,4,5-Trifluorobenzylamine 3,4,5-trifluorobenzylamine (3,4,5-Trifluorophenyl)methanamine 1-(3,4,5-trifluorophenyl)methanamine Benzenemethanamine, 3,4,5-trifluoro- (9CI) |
| CAS | 235088-69-4 |
| InChI | InChI=1/C7H6F3N/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H,3,11H2 |
| Molecular Formula | C7H6F3N |
| Molar Mass | 161.12 |
| Density | 1.320±0.06 g/cm3(Predicted) |
| Boling Point | 176.3±35.0 °C(Predicted) |
| Flash Point | 69.4°C |
| Solubility | Insoluble in water. |
| Vapor Presure | 1.1mmHg at 25°C |
| pKa | 8.49±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.4736 |
| MDL | MFCD00236318 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | 2735 |
| Hazard Note | Irritant |
| Hazard Class | 8 |
| Packing Group | II |
| application | 3,4, 5-trifluorobenzylamine is used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly used in the laboratory research and development process and chemical production process. |