| Name | Tricosanoic acid |
| Synonyms | Tricosansαure 1-Tricosansαure Tricosanoic acid TRICOSANOIC ACID 1-TRICOSANOIC ACID N-TRICOSANOIC ACID CARBOXYLIC ACID C23 |
| CAS | 2433-96-7 |
| EINECS | 219-419-7 |
| InChI | InChI=1/C23H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2-22H2,1H3,(H,24,25) |
| Molecular Formula | C23H46O2 |
| Molar Mass | 354.61 |
| Density | 0.8917 (rough estimate) |
| Melting Point | 77-79°C(lit.) |
| Boling Point | 421.66°C (rough estimate) |
| Flash Point | 179.3°C |
| Solubility | Soluble in water |
| Vapor Presure | 4.4E-07mmHg at 25°C |
| Appearance | Powder |
| Color | White to Off-White |
| BRN | 1795192 |
| pKa | 4.78±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4610 (estimate) |
| MDL | MFCD00002808 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| biological activity | Tricosanoic acid is an aliphatic carboxylic acid with strong hair growth effect. |