| Name | (2R,3R)-(-)-2,3-Butanediol |
| Synonyms | D-2,3-BUTANEDIOL levo-2,3-Butanediol D(-)-2,3-BUTANEDIOL (3R)-butane-2,3-diol (R,R)-2,3-BUTANEDIOL D-2,3-BUTYLENE GLYCOL (2R,3R)-2,3-BUTANEDIOL 2,3-Butanediol,(2R,3R)- (2R,3R)-butane-2,3-diol (R,R)-(-)-2,3-BUTANEDIOL (2R,3R)-(-)-2,3-Butanediol (2R,3R)-2,3-Dihydroxybutane (R,R)-(-)-2,3-BUTANEDIOL FOR SYNTHESIS (R,R)-(-)-2,3-Butylene Glycol(R,R)-(-)-2,3-Dihydroxybutane |
| CAS | 24347-58-8 |
| EINECS | 246-186-9 |
| InChI | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4?/m1/s1 |
| InChIKey | OWBTYPJTUOEWEK-QWWZWVQMSA-N |
| Molecular Formula | C4H10O2 |
| Molar Mass | 90.12 |
| Density | 0.987 g/mL at 25 °C (lit.) |
| Melting Point | 16 °C |
| Boling Point | 77.3-77.4 °C/10 mmHg (lit.) |
| Specific Rotation(α) | -13 º (neat) |
| Flash Point | 185°F |
| Water Solubility | soluble |
| Vapor Presure | 82.8Pa at 25℃ |
| Appearance | Colorless to yellow liquid |
| Color | Clear colorless |
| Merck | 14,1568 |
| BRN | 4290593 |
| pKa | 14.67±0.20(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Stability | Stable. Hygroscopic, air sensitive. Incompatible with strong oxidizing agents, acid anhydrides, acid chlorides, chloroformates, reducing agents. Combustible. |
| Sensitive | Hygroscopic |
| Refractive Index | n20/D 1.433 |
| MDL | MFCD00064267 |
| Physical and Chemical Properties | Melting point 16°C boiling point 77.3-77.4°C 10mm Hg(lit.) specific optical rotation -13 ° (neat) density 0.992g/mL at 20°C(lit.) refractive index n20/D 1.433 flash point 185 ° F storage conditions − 20°C water solubility soluble sensitive hygropic Merck 14,1568 BRN 4290593 |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10 |
| HS Code | 29053980 |
| LogP | -0.72 at 22℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| Biological activity | (2R,3R)-(-)-2,3-Butanediol ((2R,3R)-Butane-2,3-diol) is an endogenous metabolite. |
| Uses | C2 symmetric chiral diol, with a variety of uses such as chiral auxiliaries, structural units and chiral ligands. Cyclic condensation reaction with ketone for 13CNMR optical purity determination. |