| Name | bufexamac |
| Synonyms | cp1044 cp1044j3 bufexamac bufexamicacid 4-butoxyphenylacetohydroxamicacid 4-butoxy-n-hydroxybenzeneacetamide 4-butoxy-n-hydroxy-benzeneacetamid acidep-butoxyphenylacethydroxamique 2-(4-butoxyphenyl)-N-hydroxyacetamide 2-(p-butoxyphenyl)-acetohydroxamicaci 2-(4-butoxyphenyl)acetohydroxamic acid |
| CAS | 2438-72-4 |
| EINECS | 219-451-1 |
| InChI | InChI=1/C12H17NO3/c1-2-3-8-16-11-6-4-10(5-7-11)9-12(14)13-15/h4-7,15H,2-3,8-9H2,1H3,(H,13,14) |
| Molecular Formula | C12H17NO3 |
| Molar Mass | 223.27 |
| Density | 1.1223 (rough estimate) |
| Melting Point | 153-155° |
| Boling Point | 364.56°C (rough estimate) |
| Solubility | Practically insoluble in water, soluble in dimethylformamide, slightly soluble in ethyl acetate and in methanol. |
| Appearance | neat |
| Color | White to Off-White |
| Merck | 14,1474 |
| pKa | 9.24±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.5300 (estimate) |
| In vitro study | Bufexamac is a specific inhibitor of histone type IIB (HDAC6 and HDAC10) deacetylase. Bufexamac inhibits IFN-α secretion in peripheral blood mononuclear cells. Bufexamac is a commonly used contact-related activator and is a non-steroidal anti-inflammatory drug. |
| WGK Germany | 2 |
| RTECS | AK8280000 |
| Toxicity | LD50 orally in mice, rats: >8, >4 g/kg (Lambelin) |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 4.479 ml | 22.394 ml | 44.789 ml |
| 5 mM | 0.896 ml | 4.479 ml | 8.958 ml |
| 10 mM | 0.448 ml | 2.239 ml | 4.479 ml |
| 5 mM | 0.09 ml | 0.448 ml | 0.896 ml |
| introduction | butadiene acid (bufexamac) is a non-steroidal anti-inflammatory drug, crystalline or crystalline powder, slightly smelly, easily soluble in dimethylformamide, slightly soluble in methanol or ethanol, insoluble in water or ether. |
| pharmacological action | butadiene acid is a non-steroidal anti-inflammatory analgesic, and its anti-inflammatory and analgesic effects are similar to those of phenylbutazone, without glucocorticoid adverse reactions. It can be used for rheumatoid arthritis and hip arthritis. Dermatology topical treatment of eczema, allergic dermatitis, neurodermatitis, solar dermatitis, pruritus, psoriasis, etc. |
| use | anti-inflammatory drugs synthesized with butyloxy acid are widely used in the treatment of rheumatoid arthritis, eczema and many other skin inflammations, and are equivalent to many corticosteroid preparations (such as fluocinolone cream, betamethasone cream, etc.). |
| biological activity | Bufexamac is a COX inhibitor, the target is IFN-α, EC50 is 8.9 μM. |
| Target | Value |
| IFN-α | 8.9 μM |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 3370 mg/kg; Oral-mouse LD50: 8000 mg/kg |
| stimulation data | skin-rabbit 750 mg/30 days mild |
| flammability hazard characteristics | thermal decomposition discharges toxic nitrogen oxide smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | water, dry powder, dry sand, carbon dioxide, foam, 1211 fire extinguishing agent |