| Name | 1-benzothiophene-3-carbonitrile |
| Synonyms | 3-CYANOBENZO[B]THIOPHENE Benzothiophene-3-nitrile 3-Cyano-1-benzothiophene Benzothiophene-3-carbonitrile 1-BENZOTHIOPHENE-3-CARBONITRILE 1-benzothiophene-3-carbonitrile BENZO[B]THIOPHENE-3-CARBONITRILE Benzo[b]thiophene-3-carbonitrile- |
| CAS | 24434-84-2 |
| InChI | InChI=1/C9H5NS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6H |
| Molecular Formula | C9H5NS |
| Molar Mass | 159.21 |
| Density | 1.28±0.1 g/cm3(Predicted) |
| Melting Point | 71-75°C |
| Boling Point | 312.7±15.0 °C(Predicted) |
| Flash Point | 142.889°C |
| Vapor Presure | 0.001mmHg at 25°C |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.68 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29349990 |