| Name | 2-(Dicyclohexylphosphino)biphenyl |
| Synonyms | CYCLOHEXYL JOHNPHOS 2-(DICYLOHEXYLPHOSPHINO)BIPHENYL 2-(Dicyclohexylphosphino)biphenyl 2-(DICYCLOHEXYLPHOSPHINO)BIPHENYL (2-biphenyl)dicyclohexylphosphine (2-Biphenylyl)dicyclohexylphosphine (2-BIPHENYLYL)DICYCLOHEXYLPHOSPHINE biphenyl-2-yl(dicyclohexyl)phosphane 2-(Dicyclohexylphosphino)biphenyl2-(Dicyclohexylphosphino)biphenyl |
| CAS | 247940-06-3 |
| EINECS | 480-030-2 |
| InChI | InChI=1/C24H31P/c1-4-12-20(13-5-1)23-18-10-11-19-24(23)25(21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1,4-5,10-13,18-19,21-22H,2-3,6-9,14-17H2 |
| Molecular Formula | C24H31P |
| Molar Mass | 350.48 |
| Melting Point | 102-106°C(lit.) |
| Boling Point | 499.5±24.0 °C(Predicted) |
| Flash Point | 271.7°C |
| Solubility | soluble in Toluene |
| Vapor Presure | 1.27E-09mmHg at 25°C |
| Appearance | White crystal |
| Color | white |
| BRN | 8440533 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Sensitive | Air Sensitive |
| MDL | MFCD01862441 |
| Physical and Chemical Properties | White crystals |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-13-23 |
| TSCA | No |
| HS Code | 29310099 |
| Hazard Class | AIR SENSITIVE |
| Use | As a ligand, used in coupling reactions, oxidation, substitution, and cycloaddition reactions |