| Name | 2-Chloro-3,5-dinitrobenzoic acid |
| Synonyms | 2-C-3,5-DNBA TIMTEC-BB SBB003177 2-chloro-3,5-dinitrobenzoate 2-chloro-3,5-dinitro-benzoicaci 3,5-DINITRO-2-CHLOROBENZOIC ACID 2-CHLORO-3,5-DINITROBENZOIC ACID 2-Chloro-3,5-dinitrobenzoic acid 2-carboxy-4,6-dinitrochlorobenzene Benzoic acid, 2-chloro-3,5-dinitro- |
| CAS | 2497-91-8 |
| EINECS | 219-684-9 |
| InChI | InChI=1/C7H3ClN2O6/c8-6-4(7(11)12)1-3(9(13)14)2-5(6)10(15)16/h1-2H,(H,11,12)/p-1 |
| Molecular Formula | C7H3ClN2O6 |
| Molar Mass | 246.56 |
| Density | 1.9543 (rough estimate) |
| Melting Point | 196-199°C |
| Boling Point | 240-241°C |
| Flash Point | 200.8°C |
| Vapor Presure | 2.12E-07mmHg at 25°C |
| BRN | 2146480 |
| pKa | 1.51±0.10(Predicted) |
| Refractive Index | 1.6660 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| RTECS | DG4996500 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |