| Name | Acrylates copolymer |
| Synonyms | Acrylates copolymer ethyl prop-2-enoate 2-methylprop-2-enoic acid Acrylic acid-acrylate polymer methyl 2-methylprop-2-enoate acrylic acid terpolymer, partial sodium salts Ethyl acrylate·methacrylic acid·methyl methacrylate copolymer polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate ethyl prop-2-enoate,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid 2-Propenoic acid, 2-methyl-, polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate |
| CAS | 25133-97-5 |
| EINECS | 253-242-6 |
| InChI | InChI=1/2C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3-5(6)7-4-2;1-3(2)4(5)6/h1H2,2-3H3;3H,1,4H2,2H3;1H2,2H3,(H,5,6) |
| Molecular Formula | C14H22O6 |
| Molar Mass | 286.32 |
| Density | 1.10 (30% aq.) |
| Boling Point | 99.5°C at 760 mmHg |
| Flash Point | 15.6°C |
| Vapor Presure | 38.2mmHg at 25°C |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | can be compounded with organophosphates, etc. it has special scale inhibition and dispersion effect on calcium phosphate and iron oxide sludge, and can disperse clay and oil scale, thus having certain corrosion inhibition effect. Widely used as scale and corrosion inhibitor and prefilming agent in oil field water, boiler water and various industrial cooling water systems |