| Name | 6-(1H-Pyrazol-1-yl)nicotinic acid |
| Synonyms | 6-Pyrazol-1-yl-nicotinic acid 6-(1H-Pyrazol-1-yl)nicotinic acid 6-pyrazol-1-ylpyridine-3-carboxylic acid 6-(1H-pyrazol-1-yl)pyridine-3-carboxylic acid 6-(1H-Pyrazol-1-yl)pyridine-3-carboxylic acid 3-Pyridinecarboxylic acid, 6-(1H-pyrazol-1-yl)- |
| CAS | 253315-22-9 |
| InChI | InChI=1/C9H7N3O2/c13-9(14)7-2-3-8(10-6-7)12-5-1-4-11-12/h1-6H,(H,13,14) |
| Molecular Formula | C9H7N3O2 |
| Molar Mass | 189.17 |
| Density | 1.39±0.1 g/cm3(Predicted) |
| Melting Point | 272-274℃ |
| Boling Point | 394.6±27.0 °C(Predicted) |
| Flash Point | 192.5°C |
| Vapor Presure | 6.19E-07mmHg at 25°C |
| pKa | 3.28±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.673 |
| MDL | MFCD00140749 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
| Preparation | The title compound 6-(1H-pyrazol-1-yl) pyridine-3-carboxylic acid was synthesized from 6-chloropyridine-3-carboxylic acid through amidation, hydrazine substitution, cyclization, and hydrolysis. 6-(1H-pyrazole -1-yl) pyridine -3-formic acid synthesis reaction formula is as follows: |