| Name | 5-(9-Fluorenylmethyloxycarbonylamino)-3-oxapentanoic acid |
| Synonyms | FMOC-O1PEN-OH Fmoc-5-amino-3-oxapentanoic acid [2-(FMOC-AMINO)ETHOXY]ACETIC ACID 5-(FMOC-AMINO)-3-OXAPENTANOIC ACID 5-(9-Fluorenylmethyloxycarbonylamino)-3-oxapentanoic acid 5-(9-FLUORENYLMETHYLOXYCARBONYL-AMINO)-3-OXAPENTANOIC ACID 5-(9-FLUORENYLMETHYLOXYCARBONYL-AMINO)-3-OXAPEMTANOIC ACID 5-(9-FLUOROENYLMETHYLOXYCARBONYL-AMINO)-3-OXAPEMTANOIC ACID 5-(9-Fluorenylmethyloxycarbonyl-amino)-3-oxapentanoic acid, [2-(Fmoc-amino)ethoxy]acetic acid |
| CAS | 260367-12-2 |
| InChI | InChI=1/C19H19NO5/c21-18(22)12-24-10-9-20-19(23)25-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17H,9-12H2,(H,20,23)(H,21,22) |
| Molecular Formula | C19H19NO5 |
| Molar Mass | 341.36 |
| Density | 1.287±0.06 g/cm3(Predicted) |
| Boling Point | 602.6±40.0 °C(Predicted) |
| pKa | 3.43±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.596 |
| In vitro study | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| biological activity | Fmoc-NH-PEG1-CH2COOH is a degradable ADC linker used in antibody drug conjugate (ADC) synthesis. Fmoc-NH-PEG1-CH2COOH is also a PEG-based PROTAC linker and can be used in the synthesis of PROTAC. |
| Target | Cleavable aryl/ether PEGs |
| in vitro study | ADCs are combined of an antibody to which is attached an ADC cytoxin through an ADC linker. PROTACs contains two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intrinsic ubiquitin-proteasome system to selective grade target proteins. |