| Name | 2-Chloro-6-fluoro-3-methylphenylacetic acid |
| Synonyms | RARECHEM AL BO 0941 2-Chloro-6-fluoro-3-methylphenylacetic acid 2-CHLORO-6-FLUORO-3-METHYLPHENYLACETIC ACID 6-Chloro-2-fluoro-3-methylphenylacetic acid Benzeneacetic acid, 2-chloro-6-fluoro-3-methyl- 2-Chloro-6-fluoro-m-tolylacetic acid, 3-(Carboxymethyl)-2-chloro-4-fluorotoluene |
| CAS | 261762-92-9 |
| InChI | InChI=1/C9H8ClFO2/c1-5-2-3-7(11)6(9(5)10)4-8(12)13/h2-3H,4H2,1H3,(H,12,13) |
| Molecular Formula | C9H8ClFO2 |
| Molar Mass | 202.61 |
| Density | 1.356±0.06 g/cm3(Predicted) |
| Boling Point | 302.0±37.0 °C(Predicted) |
| Flash Point | 136.5°C |
| Vapor Presure | 0.000449mmHg at 25°C |
| pKa | 3.77±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.543 |
| MDL | MFCD01631375 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| Hazard Class | IRRITANT |