| Name | 2-(4-bromophenyl)-1H-benzimidazole |
| Synonyms | BPBMZ 2-(4-Bromophenyl)Benzimidazole 2-(4-BROMOPHENYL)BENZIMIDAZOLE 2-(4-BROMOPHENYL)BENZOIMIDAZOLE 2-(4-bromophenyl)-1H-benzimidazole 2-(4-bromophenyl)-1H-benzoimidazole 1H-benzimidazole, 2-(4-bromophenyl)- 1H-Benzimidazole, 2-(4-bromophenyl)- 2-(4-broMophenyl)-1H-benzo[d]iMidazole |
| CAS | 2622-74-4 |
| InChI | InChI=1/C13H9BrN2/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H,(H,15,16) |
| Molecular Formula | C13H9BrN2 |
| Molar Mass | 273.13 |
| Density | 1.546±0.06 g/cm3(Predicted) |
| Melting Point | 299 °C |
| Boling Point | 435.0±47.0 °C(Predicted) |
| Flash Point | 216.9°C |
| Vapor Presure | 9.06E-08mmHg at 25°C |
| Appearance | Solid |
| pKa | 11.24±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.708 |
| application | 2-(4-bromophenyl) benzimidazole can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly used in laboratory research and development process and chemical and pharmaceutical production process. |