| Name | orange ot |
| Synonyms | CI 12100 ORANGE OT orange ot C.I. 12100 FAT ORANGE RR Oil Orange ss OIL ORANGE SS SOLVENT ORANGE 2 Solvent Orange 2 C.I. Solvent Orange 2 O-TOLUENE-AZO-2-NAPHTHOL 1-(O-TOLYLAZO)-2-NAPHTHOL C.I. Solvent Orange 2 (8CI) 1-[(2-methylphenyl)azo]-2-naphthol 1-[(2-methylphenyl)hydrazono]naphthalen-2(1H)-one (1Z)-1-[(2-methylphenyl)hydrazono]naphthalen-2(1H)-one |
| CAS | 2646-17-5 |
| EINECS | 220-162-8 |
| InChI | InChI=1/C17H14N2O/c1-12-6-2-5-9-15(12)18-19-17-14-8-4-3-7-13(14)10-11-16(17)20/h2-11,18H,1H3/b19-17- |
| Molecular Formula | C17H14N2O |
| Molar Mass | 262.31 |
| Density | 1.0823 (rough estimate) |
| Melting Point | 124-126°C |
| Boling Point | 405.56°C (rough estimate) |
| Flash Point | 206.7°C |
| Water Solubility | 26.23ug/L(room temperature) |
| Solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Vapor Presure | 3.34E-07mmHg at 25°C |
| Appearance | neat |
| Color | Red to Dark Red |
| BRN | 8330630 |
| pKa | 13.52±0.50(Predicted) |
| Storage Condition | Amber Vial, -20°C Freezer, Under inert atmosphere |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5500 (estimate) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 40 - Limited evidence of a carcinogenic effect |
| Safety Description | S36 - Wear suitable protective clothing. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| RTECS | QL5425000 |
| color index | 12100 |
| (IARC) carcinogen classification | 2B (Vol. 8, Sup 7) 1987 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |