| Name | 2,3-Difluorobenzaldehyde |
| Synonyms | VHR BF CF TIMTEC-BB SBB006572 2,3-fluorobenzaldehyde 2,5-DIFLUOROBENALDEHYDE 2,3-DIFLUOROBENZALDEHYDE 2,3-Difluorobenzaldehyde Benzaldehyde, 2,3-difluoro- 2,3-Difluorbenzolcarbaldehyd 2,3- twofluorobenzeneforMaldehyde 2,2',3,3',5,5',6,6'-octafluoro-4,4'-dimethylbiphenyl |
| CAS | 2646-91-5 |
| EINECS | 607-944-8 |
| InChI | InChI=1/C14H6F8/c1-3-7(15)11(19)5(12(20)8(3)16)6-13(21)9(17)4(2)10(18)14(6)22/h1-2H3 |
| Molecular Formula | C7H4F2O |
| Molar Mass | 142.1 |
| Density | 1.301 g/mL at 25 °C (lit.) |
| Melting Point | 64-65 °C |
| Boling Point | 64-65 °C/17 mmHg (lit.) |
| Flash Point | 137°F |
| Vapor Presure | 0.0216mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.301 |
| Color | Clear pale yellow |
| BRN | 2961554 |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.499(lit.) |
| Physical and Chemical Properties | Boiling Point 64 ℃-65 ℃, flash point 58 ℃, refractive index 1.4990, specific gravity 1.301. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 29130000 |
| Hazard Note | Irritant |
| Hazard Class | 3 |
| Packing Group | III |
| uses | intermediates in medicine, pesticides and liquid crystal materials. |