| Name | 4-(5-Nitropyridin-2-yl)morpholine |
| Synonyms | 2-Morpholino-5-nitropyridine 4-(5-nitro-2-pyridyl)-morpholin 4-(5-NITRO-2-PYRIDYL)MORPHOLINE 4-(5-Nitropyridin-2-yl)morpholine 4-(5-NITROPYRIDIN-2-YL)MORPHOLINE 4-(5-NITRO-2-PYRIDINYL)MORPHOLINE 6-(4-Morpholin-1-yl)-3-nitropyridine |
| CAS | 26820-62-2 |
| InChI | InChI=1/C9H11N3O3/c13-12(14)8-1-2-9(10-7-8)11-3-5-15-6-4-11/h1-2,7H,3-6H2 |
| Molecular Formula | C9H11N3O3 |
| Molar Mass | 209.2 |
| Density | 1.325±0.06 g/cm3(Predicted) |
| Melting Point | 112-114°C |
| Boling Point | 406.4±45.0 °C(Predicted) |
| Flash Point | 199.6°C |
| Vapor Presure | 8.16E-07mmHg at 25°C |
| pKa | 1.52±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.582 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| RTECS | QE7450000 |
| Hazard Class | IRRITANT |