| Name | 6-Methoxyflavone |
| Synonyms | BRN 0218520 6-METHOXYFLAVONE 6-Methoxyflavone 6-methoxy-flavon METHOXYFLAVONE, 6- Flavone, 6-methoxy- (7CI,8CI) 6-methoxy-2-phenylchromen-4-one 6-methoxy-2-phenyl-chromen-4-one 6-Methoxy-2-phenyl-4-benzopyrone 6-methoxy-2-phenyl-4-benzopyrone 6-methoxy-2-phenyl-4H-chromen-4-one 6-methoxy-2-phenyl-4h-1-benzopyran-4-on 6-methoxy-2-phenyl-4h-1-benzopyran-4-one 6-Methoxy-2-phenyl-4H-1-benzopyran-4-one 4H-1-Benzopyran-4-one, 6-methoxy-2-phenyl- 5-18-02-00257 (Beilstein Handbook Reference) |
| CAS | 26964-24-9 |
| EINECS | 248-144-5 |
| InChI | InChI=1/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3 |
| Molecular Formula | C16H12O3 |
| Molar Mass | 252.26 |
| Density | 1.240±0.06 g/cm3(Predicted) |
| Melting Point | 163-165°C(lit.) |
| Boling Point | 421.2±45.0 °C(Predicted) |
| Flash Point | 200.3°C |
| Vapor Presure | 2.66E-07mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | `sensitive` to water |
| Refractive Index | 1.614 |
| MDL | MFCD00017322 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 2 |
| RTECS | DJ3100438 |