| Name | 1,3-Dimethyl-2-pyrazolin-5-one |
| Synonyms | NSC 304 1,3-dimethyl-5-pyrozolone 1,3-Dimethylpyrazde-5-one 1,3-diMethyl-5-pyrozolone 1,3-Dimethyl-5-pyrazolone 1,3-Dimethyl-2-pyrazolin-5-one 1,3-dimethyl-2-pyrazolin-5-one 2-Pyrazolin-5-one, 1,3-dimethyl- 2,5-DiMethyl-1H-pyrazol-3(2H)-one 1,3-DIMETHYL-4,5-DIHYDRO-1H-PYRAZOL-5-ONE 2,5-Dimethyl-2,4-dihydro-3H-pyrazol-3-one 2,5-dimethyl-2,4-dihydro-3H-pyrazol-3-one 2,5-dimethyl-1,2-dihydro-3H-pyrazol-3-one |
| CAS | 2749-59-9 |
| EINECS | 220-389-2 |
| InChI | InChI=1/C5H8N2O/c1-4-3-5(8)7(2)6-4/h3,6H,1-2H3 |
| InChIKey | JXPVQFCUIAKFLT-UHFFFAOYSA-N |
| Molecular Formula | C5H8N2O |
| Molar Mass | 112.13 |
| Density | 1.1524 (rough estimate) |
| Melting Point | 117°C |
| Boling Point | 210.05°C (rough estimate) |
| Flash Point | 49.1°C |
| Water Solubility | almost transparency |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly, Sonicated), Met |
| Vapor Presure | 2.73mmHg at 25°C |
| Appearance | Light brown-like powder |
| Color | Off-White to Light Beige |
| pKa | 2.93±0.50(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4730 (estimate) |
| MDL | MFCD00067008 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Note | Irritant |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used to make new acaricide acaride and herbicide pyrazole pesticide intermediate, used to make new pesticide acaricide acaride and herbicide pyrazole synthesis. |