| Name | alpha-Bromo-m-tolunitrile |
| Synonyms | TIMTEC-BB SBB007997 3-Cyanobenzyl bromide A-BROMO-M-TOLUNITRILE M-CYANOBENZYL BROMIDE 3-CYANOBENZYL BROMIDE α-Bromo-m-tolunitrile A-BROMO-M-TOLUONITRILE 3-Cyanide Benzyl Bromide ALPHA-BROMO-M-TOLUNITRILE alpha-Bromo-m-tolunitrile alpha-bromo-m-toluonitrile 3-(Bromoethyl)benzonitrile ALPHA-BROMO-M-TOLUONITRILE 3-(Bromomethyl)benzonitrile 3-(BROMOMETHYL)BENZONITRILE alpha-bromo-meta-tolunitrile |
| CAS | 28188-41-2 |
| EINECS | 248-890-1 |
| InChI | InChI=1/C8H6BrN/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5H2 |
| InChIKey | CVKOOKPNCVYHNY-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrN |
| Molar Mass | 196.04 |
| Density | 1.5466 (rough estimate) |
| Melting Point | 93-96°C |
| Boling Point | 130 °C / 4mmHg |
| Flash Point | 118°C |
| Water Solubility | 209mg/L at 25℃ |
| Solubility | slightly sol. in Methanol |
| Vapor Presure | 0.657Pa at 25℃ |
| Appearance | White to light brown crystals |
| Color | Almost white to beige |
| BRN | 742356 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.6550 (estimate) |
| MDL | MFCD00001809 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S28A - |
| UN IDs | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-19-21 |
| TSCA | Yes |
| HS Code | 29269095 |
| Hazard Note | Corrosive |
| Hazard Class | 8 |
| Packing Group | II |
| LogP | 2.43 at 25℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |