| Name | 4-methoxypyridine-2-carboxylic acid |
| Synonyms | Zinc02456124 IFLAB-BB F1926-0018 4-METHOXYPICOLINIC ACID 4-methoxypyridine-2-carboxylate 4-methoxy-2-pyridinecarboxylate 4-Methoxy-2-pyridinecarboxylic acid 4-METHOXYPYRIDINE-2-CARBOXYLIC ACID 4-Methoxypyridine-2-carboxylic acid 4-methoxypyridine-2-carboxylic acid 2-pyridinecarboxylic acid, 4-methoxy- |
| CAS | 29082-91-5 |
| InChI | InChI=1/C7H7NO3/c1-11-5-2-3-8-6(4-5)7(9)10/h2-4H,1H3,(H,9,10) |
| Molecular Formula | C7H7NO3 |
| Molar Mass | 153.14 |
| Density | 1.284±0.06 g/cm3(Predicted) |
| Melting Point | 197-198°C |
| Boling Point | 330.9±22.0 °C(Predicted) |
| Flash Point | 154°C |
| Vapor Presure | 6.43E-05mmHg at 25°C |
| pKa | 1.13±0.50(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.549 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |