| Name | (1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol |
| Synonyms | L-BASE (1S,2S)- D-amino-compound Adenosine DisopiuM Triphosphate 2-Amino-1-(4-nitrophenyl)propane-1,3-dio (2S)-2-aMino-1-(4-nitrophenyl)propane-1,3-diol (1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol [(1S,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]ammonium |
| CAS | 2964-48-9 |
| EINECS | 221-001-4 |
| InChI | InChI=1/C9H12N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1-4,8-9,12-13H,5,10H2/p+1/t8-,9-/m0/s1 |
| Molecular Formula | C9H12N2O4 |
| Molar Mass | 212.2 |
| Density | 1.3136 (rough estimate) |
| Melting Point | 160-166℃ |
| Boling Point | 451.9°C at 760 mmHg |
| Flash Point | 227.1°C |
| Vapor Presure | 5.92E-09mmHg at 25°C |
| Appearance | Yellow to beige crystalline powder |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.5373 (estimate) |
| Physical and Chemical Properties | Melting Point: 162 - 165 C Appearance: light yellow powder |
| Use | An effective chiral resolving agents for racemic amines. Precursor of antibiotic chloramphenicols. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| specific rotation | 31 ° (C=1 IN 6 M HCL) |
| boiling point | 352.03°C (rough estimate) |
| density | 1.3136 (rough estimate) |
| refractive index | 1.5373 (estimate) |
| storage conditions | Keep in dark place,Inert atmosphere,Room temperature |
| morphology | Crystalline Powder |
| acidity coefficient (pKa) | 10.98±0.45(Predicted) |
| color | Yellow to beige |
| optical activity (optical activity) | [α]23/D 31°, c = 1 in 6 M HCl |
| InChIKey | OCYJXSUPZMNXEN-IUCAKERBSA-N |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| customs code | 29221990 |