3,4-Dihydro-2H-isoquinolin-1-one - Names and Identifiers
| Name | 3,4-Dihydro-2H-isoquinolin-1-one
|
| Synonyms | CHEMPACIFIC 43808 3,4-dihydroisoquinolin-1-ol 3,4-Dihydro-1-isoquinolinone 3,4-DIHYDROISOQUINOLIN-1(2H)-ONE 3,4-Dihydro-2H-isoquinolin-1-one 3,4-DIHYDRO-2H-ISOQUINOLIN-1-ONE 3,4-DIHYDRO-1(2H)-ISOQUINOLINONE 1(2H)-Isoquinolinone, 3,4-dihydro- 1-oxo-1,2,3,4-tetrahydroisoquinoline
|
| CAS | 1196-38-9
|
| InChI | InChI=1/C9H9NO/c11-9-8-4-2-1-3-7(8)5-6-10-9/h1-4H,5-6H2,(H,10,11) |
3,4-Dihydro-2H-isoquinolin-1-one - Physico-chemical Properties
| Molecular Formula | C9H9NO
|
| Molar Mass | 147.17 |
| Density | 1.142 |
| Melting Point | 166 °C |
| Boling Point | 138-143 °C(Press: 0.3 Torr) |
| Flash Point | 226.5°C |
| Vapor Presure | 3.14E-06mmHg at 25°C |
| Appearance | White solid |
| pKa | 14.56±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.564 |
| MDL | MFCD00853963 |
3,4-Dihydro-2H-isoquinolin-1-one - Introduction
3,4-Dihydroisoquinolinone -1(2H)-one, also known as dihydroquinolinone, is an organic compound. Its molecular formula is C9H9NO and it has two hydrogen atoms and one oxygen atom.
Nature:
3,4-Dihydroisoquinolin-1 (2H)-one is a colorless crystal and can be dissolved in organic solvents. It is weakly alkaline and does not dissolve in water. The compound is stable at room temperature.
Use:
3,4-Dihydroisoquinoline -1(2H)-one is commonly used as an intermediate in the synthesis of drugs. It can be used to synthesize biologically active compounds, such as antibacterial agents, anticancer drugs, etc.
Preparation Method:
A common synthetic method is starting from 3,4-dihydroquinoline starting material. First, 3,4-dihydroquinoline is reacted with an acid chloride by a synthetic reaction to produce the corresponding acylated product. The oxidized product is then reduced to 3,4-dihydroisoquinolin-1 (2H)-one by a reduction reaction.
Safety Information:
There are no clear data on the toxicity and safety of 3,4-dihydroisoquinolin-1 (2H)-one. However, as an organic compound used in the laboratory, necessary safety measures need to be taken, such as wearing protective gloves, goggles and protective clothing. Any chemical should follow safe practices and be evaluated at all times on the basis of relevant information.
Last Update:2024-04-09 21:01:54