| Name | 3-Fluoro-4-methoxybenzaldehyde |
| Synonyms | 3-Fluoroanisaldehyde 3-FLUORO-4-ANISALDEHYDE 3-FLUORO-P-ANISALDEHYDE 3-Fluoro-p-anisaldehyde 3-fluoro-para-anisaldehyde 3-Fluoro-4-methoxybenzaldehyde 3-FLUORO-4-METHOXYBENZALDEHYDE 3-fluorine-4-methoxybenzaldehyde 1-fluoro-4-[(phenylsulfanyl)methyl]benzene 2-Fluoro-4-formylanisole, 3-Fluoro-p-anisaldehyde |
| CAS | 351-54-2 |
| EINECS | 206-514-3 |
| InChI | InChI=1/C13H11FS/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-9H,10H2 |
| InChIKey | SOQCZBSZZLWDGU-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO2 |
| Molar Mass | 154.14 |
| Density | 1.192±0.06 g/cm3(Predicted) |
| Melting Point | 34-35 °C (lit.) |
| Boling Point | 129-132°C 11mm |
| Flash Point | >230°F |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.000619mmHg at 25°C |
| Appearance | Oil |
| Color | Clear Colourless |
| BRN | 1942621 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.608 |
| MDL | MFCD00003349 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29130000 |
| Hazard Note | Irritant |
| Hazard Class | IRRITANT, AIR SENSIT |