| Name | 3-Chloro-7-azaindole |
| Synonyms | 3-Chloro-7-azaindole 3-CHLORO-7-AZAINDOLE 3-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE 3-Chloro-1H-pyrrolo[2,3-b]pyridine 1H-Pyrrolo[2,3-b]pyridine, 3-chloro- |
| CAS | 80235-01-4 |
| InChI | InChI=1/C7H5ClN2/c8-6-4-10-7-5(6)2-1-3-9-7/h1-4H,(H,9,10) |
| Molecular Formula | C7H5ClN2 |
| Molar Mass | 152.58 |
| Density | 1.42±0.1 g/cm3(Predicted) |
| Melting Point | 168-170 |
| Boling Point | 331.2±42.0 °C(Predicted) |
| Flash Point | 171.662°C |
| Vapor Presure | 0.001mmHg at 25°C |
| Appearance | White to Brown Solid |
| pKa | 5.98±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.703 |
| MDL | MFCD08272228 |
| Risk Codes | R22 - Harmful if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |
| Use | 3-chloro-1H-pyrrolo [2,3-B] pyridine is used as a research compound. |