| Name | 2,6-Dihydroxybenzoic acid |
| Synonyms | nsc49172 G-RESORCYLIC ACID 2,6-Resorcylic acid 2-Carboxyresorcinol 2,6-dihydroxybenzoate 6-hydroxysalicylicacid gamma-Resorcylic Acid 6-Hydroxysalicylic acid 2,6-dihydroxy-benzoicaci 2,6-Dihydroxylbenzoicacid 2,6-Dihydroxybenzoic acid RESORCINOL-2-CARBOXYLIC ACID 2,6-Dihydroxy Benzoic Acid |
| CAS | 303-07-1 |
| EINECS | 206-134-8 |
| InChI | InChI=1/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11)/p-1 |
| Molecular Formula | C7H6O4 |
| Molar Mass | 154.12 |
| Density | 1.3725 (rough estimate) |
| Melting Point | 165 °C (dec.) (lit.) |
| Boling Point | 237.46°C (rough estimate) |
| Flash Point | 175.8°C |
| Water Solubility | 9.56g/L(temperature not stated) |
| Solubility | Methanol |
| Vapor Presure | 2.65E-05mmHg at 25°C |
| Appearance | White to white-like crystals or powders |
| Color | Off-white |
| BRN | 2209755 |
| pKa | pK1:1.30 (25°C) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Sensitive to light |
| Refractive Index | 1.6400 (estimate) |
| MDL | MFCD00002462 |
| Physical and Chemical Properties |
melting point 154-155°C |
| Use | Used as pesticide, pharmaceutical intermediates |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | DG8578000 |
| TSCA | Yes |
| HS Code | 29182990 |
| Hazard Note | Irritant |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Biological activity | 2, 6-Dihydroxybenzene acid (γ-resorcylic acid, 2-Carboxyresorcinol, 2,6-Resorcylic acid) is a phenolic compound with poor biological activities such as DPPH scavenging activity and inhibiting microbial growth. |
| use | used as an intermediate for pesticides and medicines 2,6-dihydroxybenzoic acid is an intermediate for herbicides dioxalether, dioxalthione and dioxalthione, pyrimidine oxalthione, etc. |
| production method | its preparation method is to dissolve resorcinol in ethanol, add anhydrous potassium carbonate to the solution, heat to 140 ℃, and pass in carbon dioxide (carbon dioxide pressure 1400kPa) for 4h to obtain a mixture of 2,6-dihydroxybenzoic acid and 2,4-dihydroxybenzoic acid (63.1% 2,6-dihydroxybenzoic acid, 36.9% 2, 4-Dihydroxybenzoic acid), add water, then add sulfuric acid to adjust the pH of the mixture solution to 6, then evaporate part of the mixture of ethanol and water, the residue is refluxed at 98~100 ℃ for 3h, and 2, 4-dihydroxybenzoic acid is decomposed. When the decomposition reaction is carried out, the pH value of the reaction mixture is maintained at 6, and sulfuric acid is added appropriately to adjust the pH value. When the decomposition reaction is complete, add sulfuric acid to the mixture to make the pH value reach 3, and insoluble matter is formed. After filtration and separation, continue to add sulfuric acid to the filtrate to make the pH value reach 1, and cool to 5 ℃ to form 2, 6-dihydroxybenzoic acid crystallization, filtration, crystallization, washing with water, drying at 70 ℃ to obtain the finished product. |