| Name | L-Pipecolic acid |
| Synonyms | PIP-OH L-HOMOPROLINE L-Pipecolic acid (S)-PIPECOLIC ACID L-Pipecolinic acid RARECHEM BK PT F201 l(-)-pipecolinic acid (S)-(-)-PIPECOLIC ACID S-(-)-PIPECOLINIC ACID L(-)-2-Pipecolinic acid (2S)-piperidine-2-carboxylate (S)-2-PIPERIDINECARBOXYLIC ACID (S)-PIPERIDINE-2-CARBOXYLIC ACID (2S)-piperidine-2-carboxylic acid (S)-(-)-2-PIPERIDINECARBOXYLIC ACID (s)-(-)-2-piperidinecarboxylic acid |
| CAS | 3105-95-1 |
| EINECS | 221-462-1 |
| InChI | InChI=1/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/p-1/t5-/m0/s1 |
| InChIKey | HXEACLLIILLPRG-YFKPBYRVSA-N |
| Molecular Formula | C6H11NO2 |
| Molar Mass | 129.16 |
| Density | 1.1426 (rough estimate) |
| Melting Point | 272°C(lit.) |
| Boling Point | 239.22°C (rough estimate) |
| Specific Rotation(α) | -27.5 º (c=5, H2O 24 ºC) |
| Flash Point | 114.5°C |
| Water Solubility | soluble |
| Vapor Presure | 0.0026mmHg at 25°C |
| Appearance | Bright yellow crystal |
| Color | White |
| Merck | 14,7458 |
| BRN | 81093 |
| pKa | 2.28(at 25℃) |
| Storage Condition | 2-8°C |
| Refractive Index | -27 ° (C=4, H2O) |
| MDL | MFCD00005981 |
| Physical and Chemical Properties | Melting point 272°C specific optical rotation -27.5 ° (c = 5, H2O 24°C) water-soluble solution |
| Use | 272°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29339900 |
| biological activity | L(-)-Pipecolinic acid (L-Homoproline) is a normal metabolite that appears in human blood. |