| Name | 3,4-difluorophenylalanine |
| Synonyms | H-DL-Phe(3,4-F2)-OH TIMTEC-BB SBB000397 Difluorophenylalanine4 3,4-DIFLUOROPHENYLALANINE 3,4-difluorophenylalanine DL-3,4-DIFLUOROPHENYLALANINE DL-3,4-Difluorophenylalanine 3,4-DIFLUORO-DL-PHENYLALANINE 3,4-Difluoro-DL-phenylalanine 2-amino-3-(3,4-difluorophenyl)propanoic acid 2-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPIONIC ACID |
| CAS | 32133-36-1 |
| InChI | InChI=1/C9H9F2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14) |
| Molecular Formula | C9H9F2NO2 |
| Molar Mass | 201.17 |
| Density | 1.379±0.06 g/cm3(Predicted) |
| Melting Point | 237 °C |
| Boling Point | 311.9±42.0 °C(Predicted) |
| Flash Point | 142.5°C |
| Vapor Presure | 0.000234mmHg at 25°C |
| pKa | 2.16±0.20(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.536 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 36 - Wear suitable protective clothing. |
| Hazard Class | IRRITANT |