| Name | (S)-1-Octyn-3-ol |
| Synonyms | Octynol (S)-1-OCTYN-3-OL (S)-1-Octyn-3-ol (3S)-oct-1-yn-3-ol (S)-(-)-1-Octyn-3-ol (S)-(-)-1-OCTYN-3-OL (S)-1-Octyn-3-ol [omega Side-Chain Unit for PG Synthesis] |
| CAS | 32556-71-1 |
| EINECS | 212-455-4 |
| InChI | InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m1/s1 |
| Molecular Formula | C8H14O |
| Molar Mass | 126.2 |
| Density | 0.864g/mLat 25°C(lit.) |
| Melting Point | -39°C (estimate) |
| Boling Point | 100°C20mm Hg(lit.) |
| Flash Point | 147°F |
| Vapor Presure | 0.496mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light yellow to Light orange |
| BRN | 2037703 |
| pKa | 13.41±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.442(lit.) |
| MDL | MFCD00191475 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29052990 |
| Packing Group | III |
| uses | key intermediates for the synthesis of prostaglandins. |