| Name | 2-Hydroxy-6-aminopurine |
| Synonyms | ISOGUANINE Isoguanine 2-Hydroxyadenine 2-Hydroxy-6-aminopurine 2-HYDROXY-6-AMINOPURINE 2-Amino-6-hydroxy purine 6-AMINO-1,7-DIHYDROPURIN-2-ONE 6-AMINO-1,3-DIHYDRO-2H-PURIN-2-ONE 6-amino-3,5-dihydro-2H-purin-2-one 6-Amino-3,7-dihydro-2H-purin-2-one 6-amino-1,7-dihydro-2H-purin-2-one |
| CAS | 3373-53-3 |
| EINECS | 222-157-6 |
| InChI | InChI=1/C5H5N5O/c6-3-2-4(8-1-7-2)10-5(11)9-3/h1-2H,(H3,6,7,8,9,10,11) |
| InChIKey | DRAVOWXCEBXPTN-UHFFFAOYSA-N |
| Molecular Formula | C5H5N5O |
| Molar Mass | 151.13 |
| Density | 1.4456 (rough estimate) |
| Melting Point | 300 °C |
| Boling Point | 273.11°C (rough estimate) |
| Water Solubility | SLIGHTLY SOLUBLE |
| Solubility | Aqueous Base (Slightly) |
| Appearance | Powder |
| Color | Off-white to slightly beige |
| pKa | 5.32±0.40(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Stability | Hygroscopic |
| Refractive Index | 1.8000 (estimate) |
| MDL | MFCD00142931 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| HS Code | 29335995 |
| Biological activity | Isoguanine is purine base, which is an isomer of guanine. Organic synthetic blocks. |