| Name | 2,6-Dimethoxybenzaldehyde |
| Synonyms | NSC 72362 TIMTEC-BB SBB006541 DIMETHOXYBENZALDEHYDE 6-DiMethoxybenzaldehyde 2,6-DIMETHOXYBENZALDEHYDE 2,6-Dimethoxybenzaldehyde Benzaldehyde, 2,6-dimethoxy- 1,3-Dimethoxy-2-formylbenzene 2-ethyl-2-methyl-3-oxobutanoic acid ethyl ester |
| CAS | 3392-97-0 |
| InChI | InChI=1/C9H10O3/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-6H,1-2H3 |
| InChIKey | WXSGQHKHUYTJNB-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
| Molar Mass | 166.17 |
| Density | 1.1708 (rough estimate) |
| Melting Point | 96-98 °C (lit.) |
| Boling Point | 285 °C (lit.) |
| Flash Point | 285°C |
| Solubility | Soluble in Methanol (almost transparency). |
| Vapor Presure | 0.00217mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Yellow to beige |
| BRN | 908138 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.5500 (estimate) |
| MDL | MFCD00010862 |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29124990 |
| use | as a pharmaceutical intermediate |