| Name | 3-Fluorosalicylic acid |
| Synonyms | QVR BQ CF NSC 109100 RARECHEM AL BE 0031 3-Fluorosalicylic acid 3-FLUOROSALICYLIC ACID Salicylic acid, 3-fluoro- 3-Fluoro-2-hydroxybenzoicacid 2-Hydroxy-3-fluorobenzoic acid 3-FLUORO-2-HYDROXYBENZOIC ACID 3-Fluoro-2-Hydroxybenzoic acid Benzoic acid, 3-fluoro-2-hydroxy- 3-Fluorosalicylic acid, 2-Carboxy-6-fluorophenol 3-FLUORO-2-HYDROXYBENZOIC ACID(3-FLUOROSALICYLIC ACID) |
| CAS | 341-27-5 |
| InChI | InChI=1/C7H5FO3/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | GFHCXVJXSLGRJR-UHFFFAOYSA-N |
| Molecular Formula | C7H5FO3 |
| Molar Mass | 156.11 |
| Density | 1.492 |
| Melting Point | 142 °C |
| Boling Point | 271℃ |
| Flash Point | 117℃ |
| Solubility | Soluble in methanol. |
| Vapor Presure | 0.00336mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow to Light orange |
| pKa | 2.45±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.585 |
| MDL | MFCD00153167 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| HS Code | 29182900 |
| Hazard Note | Corrosive |
| Hazard Class | IRRITANT |