| Name | tetrahydro-2H-pyran-4-carboxamide |
| Synonyms | 4-CARBAMOYLTETRAHYDROPYRAN Tetrahydropyran-4-carboxamid tetrahydropyran-4-carboxamide 4-Carbamoyltetrahydro-2H-pyran TETRAHYDRO-2H-PYRAN-4-CARBOXAMIDE tetrahydro-2H-pyran-4-carboxamide 2H-pyran-4-carboxamide, tetrahydro- 3,4,5,6-Tetrahydro-2H-pyran-4-carboxamide |
| CAS | 344329-76-6 |
| InChI | InChI=1/C6H11NO2/c7-6(8)5-1-3-9-4-2-5/h5H,1-4H2,(H2,7,8) |
| Molecular Formula | C6H11NO2 |
| Molar Mass | 129.16 |
| Density | 1.114 |
| Melting Point | 181-183 |
| Boling Point | 312.1±31.0 °C(Predicted) |
| Flash Point | 191.196°C |
| Vapor Presure | 0.001mmHg at 25°C |
| pKa | 16.31±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.477 |
| Risk Codes | R22 - Harmful if swallowed R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36/37 - Wear suitable protective clothing and gloves. |
| HS Code | 29339900 |
| Hazard Note | Irritant/Keep Cold |
| Hazard Class | IRRITANT |