| Name | p-Methylthiobenzaldehyde |
| Synonyms | AKOS BBS-00003173 4-ALDEHYDE THIOANISOLE p-Methylthiobenzaldehyde 4-(methylthio)-benzaldehyd 4-methyl-thio benzaldehyde 4-(Methylthio)benzaldehyde 4-(METHYLTHIO)BENZALDEHYDE 4-METHYLMERCAPTOBENZALDEHYDE p-Methylmercaptobenzaldehyde 4-(methylsulfanyl)benzaldehyde METHYLMERCAPTOBENZALDEHYDE(4-) 4-methylbenzenecarbothialdehyde (4-METHYLTHIOCYCLOHEXYL)METHANOL |
| CAS | 3446-89-7 |
| EINECS | 222-365-7 |
| InChI | InChI=1/C8H8S/c1-7-2-4-8(6-9)5-3-7/h2-6H,1H3 |
| InChIKey | QRVYABWJVXXOTN-UHFFFAOYSA-N |
| Molecular Formula | C8H8OS |
| Molar Mass | 152.21 |
| Density | 1.144g/mLat 25°C(lit.) |
| Melting Point | 6 °C |
| Boling Point | 86-90°C1mm Hg(lit.) |
| Flash Point | >230°F |
| Water Solubility | Not miscible in water. |
| Vapor Presure | 0.324mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.144 |
| Color | Clear yellow |
| BRN | 636158 |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Stench |
| Refractive Index | n20/D 1.646(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S7/9 - |
| UN IDs | UN 3334 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 13 |
| TSCA | Yes |
| HS Code | 29309070 |
| Hazard Note | Irritant/Stench |
| LogP | 2.24 at 30℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |