| Name | Butylpyrrolidone |
| Synonyms | Butylpyrrolidone N-BUTYL pyrrolidone 1-BUTYL-2-PYRROLIDONE 1-Butyl-2-Pyrrodidone N-Butyl-2-pyrrolidone 1-N-butyl-2-prrolidone 1-butyl-2-pyrrolidione 1-butyl-2-pyrrolidinon 1-butylpyrrolidin-2-one 1-n-Butyl-2-pyrrolidone 1-Butyl-2-pyrrolizinone 1-N-BUTYL-2-PYRROLIDONE N-Butyl-2-pyrrolidinone 1-Butyl-2-pyrrolidinone N-BUTYL-2-AZACYCLOPENTANONE |
| CAS | 3470-98-2 |
| EINECS | 222-437-8 |
| InChI | InChI=1/C8H15NO/c1-2-3-6-9-7-4-5-8(9)10/h2-7H2,1H3 |
| Molecular Formula | C8H15NO |
| Molar Mass | 141.21 |
| Density | 0,96 g/cm3 |
| Boling Point | 137 °C / 28mmHg |
| Flash Point | 103°C |
| Water Solubility | 1000g/L at 20℃ |
| Solubility | Chloroform (Slightly) |
| Vapor Presure | 13Pa at 25℃ |
| Appearance | Oil |
| Color | Colourless |
| pKa | -0.41±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.4640 to 1.4660 |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| RTECS | UY5746000 |
| LogP | 1.265 at 20℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |