| Name | D-Cystine |
| Synonyms | D-CYSTINE D-Cystine H-D-CYSTINE D(+)-CYSTINE (H-D-CYS-OH)2 D-CYSTINE CRYSTALLINE D(+)-3,3-Dithiobis(2-aminopropanoic acid) D(+)-3,3'-DITHIOBIS(2-AMINOPROPANOIC ACID) (S,S)-3,3'-DITHIOBIS(2-AMINOPROPIONIC ACID) H-D-(Cys)_2-OH~(+)-3,3-Dithiobis(2-aminopropionic acid) |
| CAS | 349-46-2 |
| EINECS | 206-486-2 |
| InChI | InChI=1/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
| InChIKey | LEVWYRKDKASIDU-QWWZWVQMSA-N |
| Molecular Formula | C6H12N2O4S2 |
| Molar Mass | 240.3 |
| Density | 1.358 (estimate) |
| Melting Point | 265 °C (dec.) (lit.) |
| Boling Point | 468.2±45.0 °C(Predicted) |
| Specific Rotation(α) | 214 º (c=1, 1 N HCl) |
| Flash Point | 237°C |
| Water Solubility | 0.057 g/L (25 ºC) |
| Solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly) |
| Vapor Presure | 4.62E-10mmHg at 25°C |
| Appearance | Fine Crystalline Powder |
| Color | White |
| Merck | 14,2782 |
| BRN | 1728093 |
| pKa | 1.70±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.6000 (estimate) |
| MDL | MFCD00002610 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29309013 |
| biological activity | D-Cystine are L-Cystine D-type enantiomers. D-Cystine inhibits the activity of L-aspartate-β-semialdehyde dehydrogenase (ASADH) in Escherichia coli. |
| target | IC50: L-aspartate-β-semialdehyde dehydrogenase (ASADH) |
| uses | important pharmaceutical intermediates, preparation of compound amino acid oral preparations or infusion, dyeing agents, cosmetics, dairy additives, grease antioxidants, etc. Also used in heavy metal antidote, hepatitis and other drugs. It has the ability to promote the redox of body cells, increase white blood cells to prevent the development of pathogenic bacteria, reduce leukemia, coronary heart disease, prevent fatty liver cirrhosis, promote hair growth and prevent skin aging, but also typhoid dysentery, influenza, etc., asthma, neuralgia, eczema and Various poisoning diseases. |