| Name | 4-Fluoroacetanilide |
| Synonyms | NSC 10349 AI3-52222 BRN 2208090 4-Fluoroacetanilide p-Fluoroacetanilide Acetanilide, 4'-fluoro- N-p-Fluorophenylacetamide N-(4-Fluorophenyl)acetamide Acetamide, N-(4-fluorophenyl)- (9CI) |
| CAS | 351-83-7 |
| EINECS | 206-515-9 |
| InChI | InChI=1/C8H8FNO/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,1H3,(H,10,11) |
| Molecular Formula | C8H8FNO |
| Molar Mass | 153.16 |
| Density | 1.1655 (estimate) |
| Melting Point | 153-155℃ |
| Boling Point | 300.6±25.0 °C(Predicted) |
| Water Solubility | practically insoluble |
| BRN | 2208090 |
| pKa | 14.10±0.70(Predicted) |
| Storage Condition | Room Temprature |
| MDL | MFCD00016335 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 2 |
| RTECS | AE2977000 |
| Hazard Class | IRRITANT |
| Packing Group | 29242990 |
| Downstream Products | 2-Bromo-5-fluoroaniline 1-BROMO-4-FLUORO-2-NITROBENZENE 2-AMINO-5-FLUOROACETOPHENONE |
| NIST chemical information | Acetanilide, 4'-fluoro-(351-83-7) |