| Name | 2,3,6-Trifluoropyridine |
| Synonyms | CL016 2,3,6-Trifluoropyridine 2,3,6-TRIFLUOROPYRIDINE 2,3,6-TRIBROMO-P-CRESOL Pyridine, 2,3,6-trifluoro- |
| CAS | 3512-18-3 |
| EINECS | 680-721-0 |
| InChI | InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| Molecular Formula | C5H2F3N |
| Molar Mass | 133.07 |
| Density | 1,499 g/cm3 |
| Melting Point | 115-116 °C |
| Boling Point | 100-102°C |
| Flash Point | 30°C |
| Water Solubility | Not miscible or difficult to mix in water. |
| Vapor Presure | 15.9mmHg at 25°C |
| Specific Gravity | 1.499 |
| BRN | 1365146 |
| pKa | -8.51±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.42 |
| MDL | MFCD03001158 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R10 - Flammable |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37 - Wear suitable gloves. |
| UN IDs | 1993 |
| Hazard Note | Flammable/Irritant |
| Hazard Class | 3 |
| Packing Group | III |
| Properties | 2,3, 6-trifluoropyridine is a chemical substance and a transparent colorless liquid. |
| Preparation | 2,3, 6-trifluoropyridine can be obtained by removing one fluorine from 2,3, 5,6-tetrafluoropyridine. It has been reported that 2,3, 6-trifluoropyridine can be used to prepare small molecule inhibitors of MALT1. |