| Name | 2'-hydroxy-3-phenylpropiophenone |
| Synonyms | 2'-Hydroxydihydrochalcone O-Hydroxylphenyl phenylpropone O-Hydroxylphenyl phenyl propon 2-HYDROXY-3-PHENYLPROPIOPHENONE 2-Hydroxyphenyl-3-Propiophenone β-Phenyl-2-hydroxypropiophenone 2-Hydroxy-3-phenyl propiophenone 2'-hydroxy-3-phenylpropiophenone 2'-HYDROXY-3-PHENYLPROPIOPHENONE O-HYDROXY-BETA-PHENYL PROPIOPHENONE 1-(2-HYDROXYPHENYL)-3-PHENYLPROPANONE 1-(2-hydroxyphenyl)-3-phenylpropan-1-one 1-(2-HYDROXYPHENYL)-3-PHENYLPROPAN-1- ONE |
| CAS | 3516-95-8 |
| EINECS | 222-521-4 |
| InChI | InChI=1/C15H14O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-9,16H,10-11H2 |
| Molecular Formula | C15 H14 O2 |
| Molar Mass | 226.27 |
| Density | 1.150±0.06 g/cm3(Predicted) |
| Melting Point | 36-37°C(lit.) |
| Boling Point | 158°C/2mmHg(lit.) |
| Flash Point | >230°F |
| Solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethyl Acetate (Slightly), Eth |
| Vapor Presure | 2.38E-06mmHg at 25°C |
| Appearance | Bright yellow solid or liquid |
| Color | Off-White Low Melting |
| Maximum wavelength(λmax) | ['324nm(MeOH)(lit.)'] |
| pKa | 8.07±0.30(Predicted) |
| Storage Condition | Refrigerator |
| Refractive Index | n20/D 1.5968(lit.) |
| MDL | MFCD00002221 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | 2 '-hydroxy-3-phenylphenylketone is a ketone derivative and can be used as a preservative. |