| Name | 4-Fluoro-1-iodo-2-nitrobenzene |
| Synonyms | 5-FLUORO-2-IODONITROBENZENE 2-IODO-5-FLUORONITROBENZENE 4-Fluoro-2-Nitroiodobenzene 2-Iodo-5-fluoronitrobenzene 5-fluoro-2-iodonitrobenzene 4-Fluoro-1-iodo-2-nitrobenzene 4-FLUORO-1-IODO-2-NITROBENZENE 1-FLUORO-4-IODO-3-NITROBENZENE |
| CAS | 364-77-2 |
| EINECS | 642-661-3 |
| InChI | InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| Molecular Formula | C6H3FINO2 |
| Molar Mass | 267 |
| Density | 2.093 |
| Boling Point | 110°C 4mm |
| Flash Point | 110°C/4mm |
| Vapor Presure | 0.00155mmHg at 25°C |
| Appearance | powder to lump |
| Color | Light yellow to Yellow to Orange |
| BRN | 3253380 |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Light Sensitive |
| Refractive Index | 1.615 |
| MDL | MFCD00153169 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29049090 |
| Hazard Note | Irritant |
| Hazard Class | IRRITANT, LIGHT SENS |