| Name | 5-ethylthiophene-2-carbaldehyde |
| Synonyms | AKOS B003568 ART-CHEM-BB B003568 2-ETHYL-5-FORMYLTHIOPHENE 5-ETHYL-2-THIOPHENECARBALDEHYDE 5-ethylthiophene-2-carbaldehyde 5-ETHYL-THIOPHENE-2-CARBALDEHYDE 5-ethyl-2-thiophenecarboxaldehyd 5-ETHYLTHIOPHENE-2-CARBOXALDEHYDE 5-ETHYL-2-THIOPHENECARBOXALDEHYDE 5-Ethyl-2-Thiophenecarboxaldehyde 5-Ethyl-2-thiophene carboxaldehyde |
| CAS | 36880-33-8 |
| EINECS | 253-252-0 |
| InChI | InChI=1/C7H8OS/c1-2-6-3-4-7(5-8)9-6/h3-5H,2H2,1H3 |
| Molecular Formula | C7H8OS |
| Molar Mass | 140.2 |
| Density | 1.12g/mLat 25°C(lit.) |
| Melting Point | 65°C |
| Boling Point | 65°C2mm Hg(lit.) |
| Flash Point | 229°F |
| Vapor Presure | 0.0766mmHg at 25°C |
| BRN | 108539 |
| Storage Condition | Refrigerator |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.57(lit.) |
| MDL | MFCD00143457 |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29349990 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |