| Name | 7-Amino-5-bromoindole |
| Synonyms | 5-Bromo-7-indolamine 5-BROMO-7-INDOLAMINE 7-AMINO-5-BROMOINDOLE 7-Amino-5-bromoindole 5-BROMO-1H-INDOL-7-AMINE 5-bromo-1H-indol-7-amine |
| CAS | 374537-99-2 |
| InChI | InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
| Molecular Formula | C8H7BrN2 |
| Molar Mass | 211.06 |
| Density | 1.753g/cm3 |
| Melting Point | 104-105°C |
| Boling Point | 405.6°C at 760 mmHg |
| Flash Point | 199.1°C |
| Vapor Presure | 8.68E-07mmHg at 25°C |
| Storage Condition | 2-8°C(protect from light) |
| Sensitive | Air Sensitive |
| Refractive Index | 1.779 |
| MDL | MFCD02093961 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R25 - Toxic if swallowed |
| Safety Description | S22 - Do not breathe dust. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN2811 |
| Hazard Class | 6.1 |
| Packing Group | III |