| Name | Di(1-adamantyl)benzylphosphine |
| Synonyms | cataCXium(R) ABn Benzyldi-1-Adamantylphosphine Di(1-adamantyl)benzylphosphine Di(adaMantan-1-yl)(benzyl)phosphine BENZYLDI-1-ADAMANTYLPHOSPHINE [CATACXIUM ABN] |
| CAS | 395116-70-8 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C27H37P/c1-2-4-19(5-3-1)18-28(26-12-20-6-21(13-26)8-22(7-20)14-26)27-15-23-9-24(16-27)11-25(10-23)17-27/h1-5,20-25H,6-18H2 |
| Molecular Formula | C27H37P |
| Molar Mass | 392.56 |
| Melting Point | 183°C |
| Appearance | Powder |
| Color | yellow |
| BRN | 9359745 |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Sensitive | air sensitive |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29319090 |